Products 94666-17-8
CAS 94666-17-8 is the registry number for (+)-Amosulalol. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(1S)-1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfonamide (CAS 94666-17-8) is a chemical compound with the molecular formula C18H24N2O5S and a molecular weight of 380.5 g/mol. IUPAC name: 5-[(1S)-1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfonamide. InChIKey: LVEXHFZHOIWIIP-OAHLLOKOSA-N.
| Molecular formula | C18H24N2O5S |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 5-[(1S)-1-hydroxy-2-[2-(2-methoxyphenoxy)ethylamino]ethyl]-2-methylbenzenesulfonamide |
| InChIKey | LVEXHFZHOIWIIP-OAHLLOKOSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](CNCCOC2=CC=CC=C2OC)O)S(=O)(=O)N |
Computed by PubChem (NCBI)