CAS 946681-81-8 is the registry number for 2-(2,2-Dimethyl-propionylamino)-n-methoxy-n-methyl-isonicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-4-carboxamide (CAS 946681-81-8) is a chemical compound with the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-4-carboxamide. InChIKey: ZECTXKVADDIPOY-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O3 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-N-methoxy-N-methylpyridine-4-carboxamide |
| InChIKey | ZECTXKVADDIPOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)