CAS 946728-44-5 appears in our catalog under these names: 2-(3-(Dimethylamino)phenoxy)-5-methylaniline, 3-(2-Amino-4-methylphenoxy)-N,N-dimethylaniline, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-[3-(dimethylamino)phenoxy]-5-methylaniline (CAS 946728-44-5) is a chemical compound with the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. IUPAC name: 2-[3-(dimethylamino)phenoxy]-5-methylaniline. InChIKey: UQKDETZBRPEFEL-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O |
|---|---|
| Molecular weight | 242.32 g/mol |
| IUPAC name | 2-[3-(dimethylamino)phenoxy]-5-methylaniline |
| InChIKey | UQKDETZBRPEFEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=CC=CC(=C2)N(C)C)N |
Computed by PubChem (NCBI)