Products 947141-77-7

CAS 947141-77-7 is the registry number for Trans-(4-iodomethyl-cyclohexyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[4-(iodomethyl)cyclohexyl]carbamate (CAS 947141-77-7) is a chemical compound with the molecular formula C12H22INO2 and a molecular weight of 339.21 g/mol. IUPAC name: tert-butyl N-[4-(iodomethyl)cyclohexyl]carbamate. InChIKey: TXUVIAIKVHYALX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22INO2
Molecular weight339.21 g/mol
IUPAC nametert-butyl N-[4-(iodomethyl)cyclohexyl]carbamate
InChIKeyTXUVIAIKVHYALX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC(CC1)CI

Computed by PubChem (NCBI)