CAS 947144-60-7 appears in our catalog under these names: 2,6-Dibromo-4-chloro-3-nitropyridine, 2,6-Dibromo-4-chloro-3-nitropyridine 98%, 2,6-Dibromo-4-chloro-3-nitropyridine, 98%, 98%, 2,6-Dibromo-4-chloro-3-nitropyridine, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g.
2,6-dibromo-4-chloro-3-nitropyridine (CAS 947144-60-7) is a chemical compound with the molecular formula C5HBr2ClN2O2 and a molecular weight of 316.33 g/mol. IUPAC name: 2,6-dibromo-4-chloro-3-nitropyridine. InChIKey: QRXWPXAALPTEFY-UHFFFAOYSA-N.
| Molecular formula | C5HBr2ClN2O2 |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | 2,6-dibromo-4-chloro-3-nitropyridine |
| InChIKey | QRXWPXAALPTEFY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Br)Br)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)