CAS 947146-17-0 is the registry number for Ethyl (2,6-dichloro-3-nitropyridin-4-yl)carbamate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl N-(2,6-dichloro-3-nitro-4-pyridinyl)carbamate (CAS 947146-17-0) is a chemical compound with the molecular formula C8H7Cl2N3O4 and a molecular weight of 280.06 g/mol. IUPAC name: ethyl N-(2,6-dichloro-3-nitro-4-pyridinyl)carbamate. InChIKey: KFATWOQNHFAQHS-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3O4 |
|---|---|
| Molecular weight | 280.06 g/mol |
| IUPAC name | ethyl N-(2,6-dichloro-3-nitro-4-pyridinyl)carbamate |
| InChIKey | KFATWOQNHFAQHS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)