Products 947164-82-1

CAS 947164-82-1 is the registry number for 2-((1-Hydroxy-1,3-dihydrobenzo[c][1,2]oxaborol-6-yl)oxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetic acid (CAS 947164-82-1) is a chemical compound with the molecular formula C9H9BO5 and a molecular weight of 207.98 g/mol. IUPAC name: 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetic acid. InChIKey: XGNLRGRSKLLONA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BO5
Molecular weight207.98 g/mol
IUPAC name2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetic acid
InChIKeyXGNLRGRSKLLONA-UHFFFAOYSA-N
SMILESB1(C2=C(CO1)C=CC(=C2)OCC(=O)O)O

Computed by PubChem (NCBI)