CAS 947164-82-1 is the registry number for 2-((1-Hydroxy-1,3-dihydrobenzo[c][1,2]oxaborol-6-yl)oxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetic acid (CAS 947164-82-1) is a chemical compound with the molecular formula C9H9BO5 and a molecular weight of 207.98 g/mol. IUPAC name: 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetic acid. InChIKey: XGNLRGRSKLLONA-UHFFFAOYSA-N.
| Molecular formula | C9H9BO5 |
|---|---|
| Molecular weight | 207.98 g/mol |
| IUPAC name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetic acid |
| InChIKey | XGNLRGRSKLLONA-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)OCC(=O)O)O |
Computed by PubChem (NCBI)