CAS 947191-19-7 appears in our catalog under these names: 1-N-Ethoxycarbonyl-indazole-5-boronic acid pinacol ester, 98%, Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxylate (CAS 947191-19-7) is a chemical compound with the molecular formula C16H21BN2O4 and a molecular weight of 316.2 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxylate. InChIKey: WGBOIRLHBDFLAS-UHFFFAOYSA-N.
| Molecular formula | C16H21BN2O4 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-3-carboxylate |
| InChIKey | WGBOIRLHBDFLAS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NN=C3C(=O)OCC |
Computed by PubChem (NCBI)