Products 947257-66-1
CAS 947257-66-1 appears in our catalog under these names: D–3263, D-3263. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 25mg, 50mg, 100mg, 10mg, 20mg, 5mg, Get quote.
3-(2-aminoethyl)-5-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]benzimidazol-2-one (CAS 947257-66-1) is a chemical compound with the molecular formula C21H31N3O3 and a molecular weight of 373.5 g/mol. IUPAC name: 3-(2-aminoethyl)-5-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]benzimidazol-2-one. InChIKey: ZGTYTFYRCIRWBL-HYVNUMGLSA-N.
| Molecular formula | C21H31N3O3 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 3-(2-aminoethyl)-5-methoxy-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]benzimidazol-2-one |
| InChIKey | ZGTYTFYRCIRWBL-HYVNUMGLSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)N2C3=C(C=C(C=C3)OC)N(C2=O)CCN)C(C)C |
Computed by PubChem (NCBI)