CAS 947515-76-6 is the registry number for Homsi (r) 2,4,6-trimethylphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol (CAS 947515-76-6) is a chemical compound with the molecular formula C18H24OSi and a molecular weight of 284.5 g/mol. IUPAC name: [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol. InChIKey: SZEWDPYNFNJUHJ-UHFFFAOYSA-N.
| Molecular formula | C18H24OSi |
|---|---|
| Molecular weight | 284.5 g/mol |
| IUPAC name | [2-[dimethyl-(2,4,6-trimethylphenyl)silyl]phenyl]methanol |
| InChIKey | SZEWDPYNFNJUHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)[Si](C)(C)C2=CC=CC=C2CO)C |
Computed by PubChem (NCBI)