CAS 947533-15-5 appears in our catalog under these names: {4-((Trifluoromethyl)sulfanyl)phenyl}boronic acid, B-[4-[(Trifluoromethyl)thio]phenyl]boronic acid, 95+%, 95+%, (4-((Trifluoromethyl)thio)phenyl)boronic acid, 95+%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 50mg, 100mg, 250mg, 1g, 25g.
[4-(trifluoromethylsulfanyl)phenyl]boronic acid (CAS 947533-15-5) is a chemical compound with the molecular formula C7H6BF3O2S and a molecular weight of 222.00 g/mol. IUPAC name: [4-(trifluoromethylsulfanyl)phenyl]boronic acid. InChIKey: LCTCJAHRVYNYTQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O2S |
|---|---|
| Molecular weight | 222.00 g/mol |
| IUPAC name | [4-(trifluoromethylsulfanyl)phenyl]boronic acid |
| InChIKey | LCTCJAHRVYNYTQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(F)(F)F)(O)O |
Computed by PubChem (NCBI)