CAS 947601-87-8 appears in our catalog under these names: Flufenacet ESA Sodium Salt, >95% (HPLC), Flufenacet-ethane sulfonic acid (ESA) sodium, Flufenacet-ethane sulfonic acid (ESA) sodium 100 µg/mL in Acetonitrile, Flufenacet ESA sodium salt, Concentration: 100 µg/ml Solvent: Acetonitrile, Flufenacet ESA sodium salt. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 25mg, 50mg, 5mg, 10mg, 1ml, 1x1ml, 1x10mg.
Sodium 2-(4-fluoro-N-propan-2-ylanilino)-2-oxoethanesulfonate (CAS 947601-87-8) is a chemical compound with the molecular formula C11H13FNNaO4S and a molecular weight of 297.28 g/mol. IUPAC name: sodium 2-(4-fluoro-N-propan-2-ylanilino)-2-oxoethanesulfonate. InChIKey: QKYDPLRLNWGQEJ-UHFFFAOYSA-M.
| Molecular formula | C11H13FNNaO4S |
|---|---|
| Molecular weight | 297.28 g/mol |
| IUPAC name | sodium 2-(4-fluoro-N-propan-2-ylanilino)-2-oxoethanesulfonate |
| InChIKey | QKYDPLRLNWGQEJ-UHFFFAOYSA-M |
| SMILES | CC(C)N(C1=CC=C(C=C1)F)C(=O)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)