CAS 947601-94-7 is the registry number for 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen carbonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethyl-3-methylimidazol-3-ium;hydrogen carbonate (CAS 947601-94-7) is a chemical compound with the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;hydrogen carbonate. InChIKey: ULMGNXSIBNEBFL-UHFFFAOYSA-M.
| Molecular formula | C7H12N2O3 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;hydrogen carbonate |
| InChIKey | ULMGNXSIBNEBFL-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.C(=O)(O)[O-] |
Computed by PubChem (NCBI)