CAS 947620-48-6 appears in our catalog under these names: E6005, Lotamilast/ 98.44% (existing batch purity), RVT–501, RVT 501, Lotamilast 98%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
Methyl 4-[[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]carbamoyl]benzoate (CAS 947620-48-6) is a chemical compound with the molecular formula C26H24N4O5 and a molecular weight of 472.5 g/mol. IUPAC name: methyl 4-[[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]carbamoyl]benzoate. InChIKey: BBTFKAOFCSOZMB-UHFFFAOYSA-N.
| Molecular formula | C26H24N4O5 |
|---|---|
| Molecular weight | 472.5 g/mol |
| IUPAC name | methyl 4-[[3-[6,7-dimethoxy-2-(methylamino)quinazolin-4-yl]phenyl]carbamoyl]benzoate |
| InChIKey | BBTFKAOFCSOZMB-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=CC(=C(C=C2C(=N1)C3=CC(=CC=C3)NC(=O)C4=CC=C(C=C4)C(=O)OC)OC)OC |
Computed by PubChem (NCBI)