CAS 947686-09-1 appears in our catalog under these names: Duloxetine Impurity 20, Duloxetine Impurity 3, Duloxetine Phenyl Carbamate (>85%), >95% (HPLC), Duloxetine Phenyl Carbamate, >95% (HPLC), Duloxetine Phenyl Carbamate. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Phenyl N-methyl-N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamate (CAS 947686-09-1) is a chemical compound with the molecular formula C25H23NO3S and a molecular weight of 417.5 g/mol. IUPAC name: phenyl N-methyl-N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamate. InChIKey: OSNZKJGSXFMSCS-QHCPKHFHSA-N.
| Molecular formula | C25H23NO3S |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | phenyl N-methyl-N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]carbamate |
| InChIKey | OSNZKJGSXFMSCS-QHCPKHFHSA-N |
| SMILES | CN(CC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32)C(=O)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)