CAS 94790-35-9 appears in our catalog under these names: TCFH, 98%, Chloro-N,N,N’,N’-tetramethyl-formamidinium Hexafluorophosphate, TCFH, Chloro-N,N,N',N'-tetramethylformamidinium Hexafluorophosphate, >98.0%(N), Chloro-N,N,N',N'-tetramethylformamidinium Hexafluorophosphate. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 500g, 1kg, 100g, 25g, 5g, 250g, 1g, 0,5kg.
[chloro(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate (CAS 94790-35-9) is a chemical compound with the molecular formula C5H12ClF6N2P and a molecular weight of 280.58 g/mol. IUPAC name: [chloro(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate. InChIKey: CUKNPSDEURGZCO-UHFFFAOYSA-N.
| Molecular formula | C5H12ClF6N2P |
|---|---|
| Molecular weight | 280.58 g/mol |
| IUPAC name | [chloro(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | CUKNPSDEURGZCO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)Cl.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)