CAS 94790-37-1 appears in our catalog under these names: HBTU, >95% (HPLC), HBTU, O-(1H-Benzotriazol-1-yl)-N,N,N',N'-tetramethyluronium hexafl, HBTU Reagent, O-(Benzotriazol-1-yl)-N,N,N',N'-tetramethyluronium hexafluorophosphate, 98%. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 5g, 100g, 1kg, 25g, 2kg, 500g, 5kg.
[dimethylamino-(3-oxidobenzotriazol-3-ium-1-yl)methylidene]-dimethylazanium hexafluorophosphate (CAS 94790-37-1) is a chemical compound with the molecular formula C11H16F6N5OP and a molecular weight of 379.24 g/mol. IUPAC name: [dimethylamino-(3-oxidobenzotriazol-3-ium-1-yl)methylidene]-dimethylazanium hexafluorophosphate. InChIKey: BSKUEERROYGAFF-UHFFFAOYSA-N.
| Molecular formula | C11H16F6N5OP |
|---|---|
| Molecular weight | 379.24 g/mol |
| IUPAC name | [dimethylamino-(3-oxidobenzotriazol-3-ium-1-yl)methylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | BSKUEERROYGAFF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)N1C2=CC=CC=C2[N+](=N1)[O-].F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)