CAS 94812-07-4 is the registry number for 1-Acetyl-3-chloroindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
1-(3-chloroindol-1-yl)ethanone (CAS 94812-07-4) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 1-(3-chloroindol-1-yl)ethanone. InChIKey: UUYRXYWVPFCULW-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 1-(3-chloroindol-1-yl)ethanone |
| InChIKey | UUYRXYWVPFCULW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)