Products 94812-07-4

CAS 94812-07-4 is the registry number for 1-Acetyl-3-chloroindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

1-(3-chloroindol-1-yl)ethanone (CAS 94812-07-4) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 1-(3-chloroindol-1-yl)ethanone. InChIKey: UUYRXYWVPFCULW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO
Molecular weight193.63 g/mol
IUPAC name1-(3-chloroindol-1-yl)ethanone
InChIKeyUUYRXYWVPFCULW-UHFFFAOYSA-N
SMILESCC(=O)N1C=C(C2=CC=CC=C21)Cl

Computed by PubChem (NCBI)