CAS 94820-64-1 is the registry number for 6-Hydroxy Warfarin-d5. Offered by: TRC. Available pack sizes: 100mg.
4,6-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one (CAS 94820-64-1) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 329.4 g/mol. IUPAC name: 4,6-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one. InChIKey: IQWPEJBUOJQPDE-VIQYUKPQSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4,6-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| InChIKey | IQWPEJBUOJQPDE-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CC(=O)C)C2=C(C3=C(C=CC(=C3)O)OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)