CAS 94820-65-2 appears in our catalog under these names: 7-Hydroxy Warfarin-d5, 7-Hydroxy Warfarin-d5, >95% (HPLC), 7–Hydroxywarfarin–d5, 7-Hydroxywarfarin-d5, 98.05%. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4,7-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one (CAS 94820-65-2) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 329.4 g/mol. IUPAC name: 4,7-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one. InChIKey: SKFYEJMLNMTTJA-VIQYUKPQSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4,7-dihydroxy-3-[3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| InChIKey | SKFYEJMLNMTTJA-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CC(=O)C)C2=C(C3=C(C=C(C=C3)O)OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)