CAS 94828-52-1 is the registry number for N-(4,6-Dimethylpyrimidin-2-yl)-n'-[3-(trifluoromethyl)phenyl]guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4,6-dimethylpyrimidin-2-yl)-1-[3-(trifluoromethyl)phenyl]guanidine (CAS 94828-52-1) is a chemical compound with the molecular formula C14H14F3N5 and a molecular weight of 309.29 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)-1-[3-(trifluoromethyl)phenyl]guanidine. InChIKey: XSCWWXRTVRDOFC-UHFFFAOYSA-N.
| Molecular formula | C14H14F3N5 |
|---|---|
| Molecular weight | 309.29 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)-1-[3-(trifluoromethyl)phenyl]guanidine |
| InChIKey | XSCWWXRTVRDOFC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N=C(N)NC2=CC=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)