CAS 948283-32-7 appears in our catalog under these names: 2-Chloro-n-[4-(pyridin-4-ylmethyl)phenyl]acetamide hydrochloride, 95%, 2-Chloro-N-(4-(pyridin-4-ylmethyl)phenyl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-chloro-N-[4-(pyridin-4-ylmethyl)phenyl]acetamide;hydrochloride (CAS 948283-32-7) is a chemical compound with the molecular formula C14H14Cl2N2O and a molecular weight of 297.2 g/mol. IUPAC name: 2-chloro-N-[4-(pyridin-4-ylmethyl)phenyl]acetamide;hydrochloride. InChIKey: UUBCJHWRZLADBF-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2O |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 2-chloro-N-[4-(pyridin-4-ylmethyl)phenyl]acetamide;hydrochloride |
| InChIKey | UUBCJHWRZLADBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC=NC=C2)NC(=O)CCl.Cl |
Computed by PubChem (NCBI)