CAS 948290-83-3 is the registry number for 2,6-Dichloro-3-(chloromethyl)quinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,6-dichloro-3-(chloromethyl)quinoline (CAS 948290-83-3) is a chemical compound with the molecular formula C10H6Cl3N and a molecular weight of 246.5 g/mol. IUPAC name: 2,6-dichloro-3-(chloromethyl)quinoline. InChIKey: BFAPZANHIDQHLK-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl3N |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 2,6-dichloro-3-(chloromethyl)quinoline |
| InChIKey | BFAPZANHIDQHLK-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Cl)CCl)Cl |
Computed by PubChem (NCBI)