CAS 948291-60-9 is the registry number for 2,6-Dichloro-8-methylquinoline-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-dichloro-8-methylquinoline-3-carbonitrile (CAS 948291-60-9) is a chemical compound with the molecular formula C11H6Cl2N2 and a molecular weight of 237.08 g/mol. IUPAC name: 2,6-dichloro-8-methylquinoline-3-carbonitrile. InChIKey: PACCOJOKRQWVLY-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2 |
|---|---|
| Molecular weight | 237.08 g/mol |
| IUPAC name | 2,6-dichloro-8-methylquinoline-3-carbonitrile |
| InChIKey | PACCOJOKRQWVLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=CC(=C(N=C12)Cl)C#N)Cl |
Computed by PubChem (NCBI)