CAS 948296-15-9 appears in our catalog under these names: D-Serine t-butyl ester HCl, D-Serine 1,1-Dimethylethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 50mg.
Tert-butyl (2R)-2-amino-3-hydroxypropanoate (CAS 948296-15-9) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-hydroxypropanoate. InChIKey: XHWXHVOIWMNRLH-RXMQYKEDSA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-hydroxypropanoate |
| InChIKey | XHWXHVOIWMNRLH-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CO)N |
Computed by PubChem (NCBI)