Products 948312-00-3
CAS 948312-00-3 is the registry number for 1,3-Dimethoxy-4-((E)-1,3-diphenylallyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-[(E)-1,3-diphenylprop-2-enyl]-2,4-dimethoxybenzene (CAS 948312-00-3) is a chemical compound with the molecular formula C23H22O2 and a molecular weight of 330.4 g/mol. IUPAC name: 1-[(E)-1,3-diphenylprop-2-enyl]-2,4-dimethoxybenzene. InChIKey: BHZZCCSOLSNRAS-FYWRMAATSA-N.
| Molecular formula | C23H22O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-[(E)-1,3-diphenylprop-2-enyl]-2,4-dimethoxybenzene |
| InChIKey | BHZZCCSOLSNRAS-FYWRMAATSA-N |
| SMILES | COC1=CC(=C(C=C1)C(/C=C/C2=CC=CC=C2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)