Products 948313-24-4
CAS 948313-24-4 is the registry number for GW694590A. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl N-[6-[4-(phenylcarbamoylamino)phenoxy]-1H-benzimidazol-2-yl]carbamate (CAS 948313-24-4) is a chemical compound with the molecular formula C22H19N5O4 and a molecular weight of 417.4 g/mol. IUPAC name: methyl N-[6-[4-(phenylcarbamoylamino)phenoxy]-1H-benzimidazol-2-yl]carbamate. InChIKey: LSYSLIJSKJGOJX-UHFFFAOYSA-N.
| Molecular formula | C22H19N5O4 |
|---|---|
| Molecular weight | 417.4 g/mol |
| IUPAC name | methyl N-[6-[4-(phenylcarbamoylamino)phenoxy]-1H-benzimidazol-2-yl]carbamate |
| InChIKey | LSYSLIJSKJGOJX-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)OC3=CC=C(C=C3)NC(=O)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)