CAS 94856-22-1 appears in our catalog under these names: 4,4,4-Trifluoro-1-(2,4-dichlorophenyl)-1,3-butanedione, 95%, 4,4,4-Trifluoro-1-(2,4-dichlorophenyl)-1,3-butanedione, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g.
1-(2,4-dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 94856-22-1) is a chemical compound with the molecular formula C10H5Cl2F3O2 and a molecular weight of 285.04 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: MFGWGSLMYPLKRX-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2F3O2 |
|---|---|
| Molecular weight | 285.04 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | MFGWGSLMYPLKRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)