CAS 948592-69-6 appears in our catalog under these names: 5-Amino-2,4-dichlorophenylboronic acid, 97%, (5-Amino-2,4-dichlorophenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(5-amino-2,4-dichlorophenyl)boronic acid (CAS 948592-69-6) is a chemical compound with the molecular formula C6H6BCl2NO2 and a molecular weight of 205.83 g/mol. IUPAC name: (5-amino-2,4-dichlorophenyl)boronic acid. InChIKey: PBNYZHWDFGLNPP-UHFFFAOYSA-N.
| Molecular formula | C6H6BCl2NO2 |
|---|---|
| Molecular weight | 205.83 g/mol |
| IUPAC name | (5-amino-2,4-dichlorophenyl)boronic acid |
| InChIKey | PBNYZHWDFGLNPP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)N)(O)O |
Computed by PubChem (NCBI)