CAS 94884-82-9 is the registry number for Ethylbromochloronitroacetate. Offered by: TRC. Available pack sizes: 25mg.
Ethyl 2-bromo-2-chloro-2-nitroacetate (CAS 94884-82-9) is a chemical compound with the molecular formula C4H5BrClNO4 and a molecular weight of 246.44 g/mol. IUPAC name: ethyl 2-bromo-2-chloro-2-nitroacetate. InChIKey: ZRWYLJCSVZVTHH-UHFFFAOYSA-N.
| Molecular formula | C4H5BrClNO4 |
|---|---|
| Molecular weight | 246.44 g/mol |
| IUPAC name | ethyl 2-bromo-2-chloro-2-nitroacetate |
| InChIKey | ZRWYLJCSVZVTHH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C([N+](=O)[O-])(Cl)Br |
Computed by PubChem (NCBI)