CAS 948843-33-2 is the registry number for (S,E)-2-Methyl-N-(3-methylbutylidene)propane-2-sulfinamide, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(NE,S)-2-methyl-N-(3-methylbutylidene)propane-2-sulfinamide (CAS 948843-33-2) is a chemical compound with the molecular formula C9H19NOS and a molecular weight of 189.32 g/mol. IUPAC name: (NE,S)-2-methyl-N-(3-methylbutylidene)propane-2-sulfinamide. InChIKey: SURNLDMUXHLWDG-PMDBQALLSA-N.
| Molecular formula | C9H19NOS |
|---|---|
| Molecular weight | 189.32 g/mol |
| IUPAC name | (NE,S)-2-methyl-N-(3-methylbutylidene)propane-2-sulfinamide |
| InChIKey | SURNLDMUXHLWDG-PMDBQALLSA-N |
| SMILES | CC(C)C/C=N/[S@@](=O)C(C)(C)C |
Computed by PubChem (NCBI)