CAS 948990-71-4 is the registry number for (R)-1-Benzoyl-4-(4-iodophenyl)sulfonyl-3-methylpiperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[(3R)-4-(4-iodophenyl)sulfonyl-3-methylpiperazin-1-yl]-phenylmethanone (CAS 948990-71-4) is a chemical compound with the molecular formula C18H19IN2O3S and a molecular weight of 470.3 g/mol. IUPAC name: [(3R)-4-(4-iodophenyl)sulfonyl-3-methylpiperazin-1-yl]-phenylmethanone. InChIKey: WRDLPDOULHEQJA-CQSZACIVSA-N.
| Molecular formula | C18H19IN2O3S |
|---|---|
| Molecular weight | 470.3 g/mol |
| IUPAC name | [(3R)-4-(4-iodophenyl)sulfonyl-3-methylpiperazin-1-yl]-phenylmethanone |
| InChIKey | WRDLPDOULHEQJA-CQSZACIVSA-N |
| SMILES | C[C@@H]1CN(CCN1S(=O)(=O)C2=CC=C(C=C2)I)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)