CAS 949022-45-1 appears in our catalog under these names: 3-Benzoylphenylboronic acid pinacol ester, 95%, 3-Benzoylphenylboronic acid pinacol ester, 95-<97%, Phenyl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 95+%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
Phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 949022-45-1) is a chemical compound with the molecular formula C19H21BO3 and a molecular weight of 308.2 g/mol. IUPAC name: phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: LAELVQOXYPYWJZ-UHFFFAOYSA-N.
| Molecular formula | C19H21BO3 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | LAELVQOXYPYWJZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)