CAS 949111-30-2 is the registry number for 1,3-(Propan-2yl)-benzimidazolium iodide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
1,3-di(propan-2-yl)benzimidazol-3-ium iodide (CAS 949111-30-2) is a chemical compound with the molecular formula C13H19IN2 and a molecular weight of 330.21 g/mol. IUPAC name: 1,3-di(propan-2-yl)benzimidazol-3-ium iodide. InChIKey: GBPXZGGGKVOMNL-UHFFFAOYSA-M.
| Molecular formula | C13H19IN2 |
|---|---|
| Molecular weight | 330.21 g/mol |
| IUPAC name | 1,3-di(propan-2-yl)benzimidazol-3-ium iodide |
| InChIKey | GBPXZGGGKVOMNL-UHFFFAOYSA-M |
| SMILES | CC(C)N1C=[N+](C2=CC=CC=C21)C(C)C.[I-] |
Computed by PubChem (NCBI)