Products 949111-30-2

CAS 949111-30-2 is the registry number for 1,3-(Propan-2yl)-benzimidazolium iodide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

1,3-di(propan-2-yl)benzimidazol-3-ium iodide (CAS 949111-30-2) is a chemical compound with the molecular formula C13H19IN2 and a molecular weight of 330.21 g/mol. IUPAC name: 1,3-di(propan-2-yl)benzimidazol-3-ium iodide. InChIKey: GBPXZGGGKVOMNL-UHFFFAOYSA-M.

Identity
Molecular formulaC13H19IN2
Molecular weight330.21 g/mol
IUPAC name1,3-di(propan-2-yl)benzimidazol-3-ium iodide
InChIKeyGBPXZGGGKVOMNL-UHFFFAOYSA-M
SMILESCC(C)N1C=[N+](C2=CC=CC=C21)C(C)C.[I-]

Computed by PubChem (NCBI)