CAS 949465-79-6 appears in our catalog under these names: 5-(3-Chloro-2-fluorobenzyl)-2,4-dimethoxybenzoic acid, 95%, 5-((3-Chloro-2-fluorophenyl)methyl)-2,4-dimethoxybenzoic Acid, 5–(3–chloro–2–fluorobenzyl)–2,4–diMethoxybenzoic acid, 5-(3-Chloro-2-fluorobenzyl)-2,4-dimethoxybenzoic acid 98+%, 5-(3-Chloro-2-fluorobenzyl)-2,4-dimethoxybenzoic acid, 98+%, 98+%. Offered by: Combi-blocks, Mikromol, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g, 25mg, 100mg, 250mg.
5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoic acid (CAS 949465-79-6) is a chemical compound with the molecular formula C16H14ClFO4 and a molecular weight of 324.73 g/mol. IUPAC name: 5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoic acid. InChIKey: KMMMWZNGDLRCHZ-UHFFFAOYSA-N.
| Molecular formula | C16H14ClFO4 |
|---|---|
| Molecular weight | 324.73 g/mol |
| IUPAC name | 5-[(3-chloro-2-fluorophenyl)methyl]-2,4-dimethoxybenzoic acid |
| InChIKey | KMMMWZNGDLRCHZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1CC2=C(C(=CC=C2)Cl)F)C(=O)O)OC |
Computed by PubChem (NCBI)