Products 949575-22-8
CAS 949575-22-8 is the registry number for MIP-1095. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[(1S)-1-carboxy-5-[(4-iodophenyl)carbamoylamino]pentyl]carbamoylamino]pentanedioic acid (CAS 949575-22-8) is a chemical compound with the molecular formula C19H25IN4O8 and a molecular weight of 564.3 g/mol. IUPAC name: (2S)-2-[[(1S)-1-carboxy-5-[(4-iodophenyl)carbamoylamino]pentyl]carbamoylamino]pentanedioic acid. InChIKey: LFEGKCKGGNXWDV-KBPBESRZSA-N.
| Molecular formula | C19H25IN4O8 |
|---|---|
| Molecular weight | 564.3 g/mol |
| IUPAC name | (2S)-2-[[(1S)-1-carboxy-5-[(4-iodophenyl)carbamoylamino]pentyl]carbamoylamino]pentanedioic acid |
| InChIKey | LFEGKCKGGNXWDV-KBPBESRZSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NCCCC[C@@H](C(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O)I |
Computed by PubChem (NCBI)