Products 949704-33-0
CAS 949704-33-0 is the registry number for 4-(4-Iodophenoxy)-1-methyl-1H-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-iodophenoxy)-1-methylpyrazolo[5,4-d]pyrimidine (CAS 949704-33-0) is a chemical compound with the molecular formula C12H9IN4O and a molecular weight of 352.13 g/mol. IUPAC name: 4-(4-iodophenoxy)-1-methylpyrazolo[5,4-d]pyrimidine. InChIKey: FTZLARAPMYPRIX-UHFFFAOYSA-N.
| Molecular formula | C12H9IN4O |
|---|---|
| Molecular weight | 352.13 g/mol |
| IUPAC name | 4-(4-iodophenoxy)-1-methylpyrazolo[5,4-d]pyrimidine |
| InChIKey | FTZLARAPMYPRIX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=NC=N2)OC3=CC=C(C=C3)I |
Computed by PubChem (NCBI)