CAS 949922-61-6 appears in our catalog under these names: 7-Boc-3-bromo-5,6-dihydro-8H-imidazo[1,2-a]pyrazine 98%, Tert-Butyl 3-Bromo-5,6-Dihydroimidazo[1,2-a]Pyrazine-7(8H)-Carboxylate, 98%, 98%, 7-Boc-3-Bromo-5,6-dihydro-8H-imidazo[1,2-a]pyrazine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Tert-butyl 3-bromo-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate (CAS 949922-61-6) is a chemical compound with the molecular formula C11H16BrN3O2 and a molecular weight of 302.17 g/mol. IUPAC name: tert-butyl 3-bromo-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate. InChIKey: YTGNTPFZMKDHEY-UHFFFAOYSA-N.
| Molecular formula | C11H16BrN3O2 |
|---|---|
| Molecular weight | 302.17 g/mol |
| IUPAC name | tert-butyl 3-bromo-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carboxylate |
| InChIKey | YTGNTPFZMKDHEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=NC=C2Br)C1 |
Computed by PubChem (NCBI)