CAS 18395-30-7 appears in our catalog under these names: Isobutyltrimethoxysilane, 95%, Diethyldithiocarbamic acid 2-benzothiazolyl ester, 98%, 2–Benzothiazolyl Diethyldithiocarbamate, 2-Benzothiazolyl Diethyldithiocarbamate, >95.0%(N), Diethyldithiocarbamic Acid 2-Benzothiazolyl Ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 500g.
1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate (CAS 95-30-7) is a chemical compound with the molecular formula C12H14N2S3 and a molecular weight of 282.5 g/mol. IUPAC name: 1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate. InChIKey: LFMQNMXVVXHZCC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S3 |
|---|---|
| Molecular weight | 282.5 g/mol |
| IUPAC name | 1,3-benzothiazol-2-yl N,N-diethylcarbamodithioate |
| InChIKey | LFMQNMXVVXHZCC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=S)SC1=NC2=CC=CC=C2S1 |
Computed by PubChem (NCBI)