CAS 950021-33-7 is the registry number for 4,5-Dibromo-N-(2,5-difluorophenyl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dibromo-N-(2,5-difluorophenyl)thiophene-2-carboxamide (CAS 950021-33-7) is a chemical compound with the molecular formula C11H5Br2F2NOS and a molecular weight of 397.04 g/mol. IUPAC name: 4,5-dibromo-N-(2,5-difluorophenyl)thiophene-2-carboxamide. InChIKey: SQNFLFBDXHQLGF-UHFFFAOYSA-N.
| Molecular formula | C11H5Br2F2NOS |
|---|---|
| Molecular weight | 397.04 g/mol |
| IUPAC name | 4,5-dibromo-N-(2,5-difluorophenyl)thiophene-2-carboxamide |
| InChIKey | SQNFLFBDXHQLGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)NC(=O)C2=CC(=C(S2)Br)Br)F |
Computed by PubChem (NCBI)