CAS 95051-10-8 appears in our catalog under these names: 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin, 95%, 5-Mono(4-carboxyphenyl)-10,15,20-triphenyl porphine, 95%, 5–(4–Carboxyphenyl)–10,15,20–triphenylporphyrin, 5-(4-Carboxyphenyl)-10,15,20-triphenylporphyrin, >98.0%(HPLC), GLN51108 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25mg, 1 g, 250 mg, 100 mg.
4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoic acid (CAS 95051-10-8) is a chemical compound with the molecular formula C45H30N4O2 and a molecular weight of 658.7 g/mol. IUPAC name: 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoic acid. InChIKey: GZTMFXHPFNRUNU-UHFFFAOYSA-N.
| Molecular formula | C45H30N4O2 |
|---|---|
| Molecular weight | 658.7 g/mol |
| IUPAC name | 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzoic acid |
| InChIKey | GZTMFXHPFNRUNU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=CC=C9)N3 |
Computed by PubChem (NCBI)