CAS 95091-93-3 is the registry number for 1-(3-BROMOPROPYL)-2,2,5,5-TETRAMETHYL-1&. Offered by: Sigma-Aldrich. Available pack sizes: 5G.
1-(3-bromopropyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (CAS 95091-93-3) is a chemical compound with the molecular formula C9H22BrNSi2 and a molecular weight of 280.35 g/mol. IUPAC name: 1-(3-bromopropyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine. InChIKey: BKBUBAVZGMRPAK-UHFFFAOYSA-N.
| Molecular formula | C9H22BrNSi2 |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | 1-(3-bromopropyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| InChIKey | BKBUBAVZGMRPAK-UHFFFAOYSA-N |
| SMILES | C[Si]1(CC[Si](N1CCCBr)(C)C)C |
Computed by PubChem (NCBI)