CAS 95095-71-9 appears in our catalog under these names: 2,3-Diamino-6-(trifluoromethyl)-4(3H)-pyrimidinone, 98%, 2,3-Diamino-6-(trifluoromethyl)pyrimidin-4(3H)-one, 97%, 2,3-Diamino-6-(trifluoromethyl)-4(3H)-pyrimidinone, 99%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.
2,3-diamino-6-(trifluoromethyl)pyrimidin-4-one (CAS 95095-71-9) is a chemical compound with the molecular formula C5H5F3N4O and a molecular weight of 194.11 g/mol. IUPAC name: 2,3-diamino-6-(trifluoromethyl)pyrimidin-4-one. InChIKey: RXJGGWLLRAKHDL-UHFFFAOYSA-N.
| Molecular formula | C5H5F3N4O |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 2,3-diamino-6-(trifluoromethyl)pyrimidin-4-one |
| InChIKey | RXJGGWLLRAKHDL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N(C1=O)N)N)C(F)(F)F |
Computed by PubChem (NCBI)