CAS 951020-81-8 appears in our catalog under these names: 1,3-Dimethoxyimidazolium hexafluorophosphate, 95%, 1,3-DIMETHOXYIMIDAZOLIUM HEXAFLUOROPHOSP. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 50g, 5g.
1,3-dimethoxyimidazol-1-ium hexafluorophosphate (CAS 951020-81-8) is a chemical compound with the molecular formula C5H9F6N2O2P and a molecular weight of 274.10 g/mol. IUPAC name: 1,3-dimethoxyimidazol-1-ium hexafluorophosphate. InChIKey: KBRFXVGODOTNGL-UHFFFAOYSA-N.
| Molecular formula | C5H9F6N2O2P |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 1,3-dimethoxyimidazol-1-ium hexafluorophosphate |
| InChIKey | KBRFXVGODOTNGL-UHFFFAOYSA-N |
| SMILES | CON1C=C[N+](=C1)OC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)