CAS 951020-84-1 is the registry number for 1,3-Dimethoxy-2-methylimidazolium hexafluorophosphate, 95%. Offered by: Combi-blocks. Available pack sizes: 50g, 5g.
1,3-dimethoxy-2-methylimidazol-1-ium hexafluorophosphate (CAS 951020-84-1) is a chemical compound with the molecular formula C6H11F6N2O2P and a molecular weight of 288.13 g/mol. IUPAC name: 1,3-dimethoxy-2-methylimidazol-1-ium hexafluorophosphate. InChIKey: JZRQUSXLKTZBJU-UHFFFAOYSA-N.
| Molecular formula | C6H11F6N2O2P |
|---|---|
| Molecular weight | 288.13 g/mol |
| IUPAC name | 1,3-dimethoxy-2-methylimidazol-1-ium hexafluorophosphate |
| InChIKey | JZRQUSXLKTZBJU-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=CN1OC)OC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)