CAS 951020-87-4 is the registry number for 1,3-Diethoxyimidazolium hexafluorophosphate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 50g.
1,3-diethoxyimidazol-1-ium hexafluorophosphate (CAS 951020-87-4) is a chemical compound with the molecular formula C7H13F6N2O2P and a molecular weight of 302.15 g/mol. IUPAC name: 1,3-diethoxyimidazol-1-ium hexafluorophosphate. InChIKey: OCMLXXOSZWGVIL-UHFFFAOYSA-N.
| Molecular formula | C7H13F6N2O2P |
|---|---|
| Molecular weight | 302.15 g/mol |
| IUPAC name | 1,3-diethoxyimidazol-1-ium hexafluorophosphate |
| InChIKey | OCMLXXOSZWGVIL-UHFFFAOYSA-N |
| SMILES | CCON1C=C[N+](=C1)OCC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)