Products 951020-87-4

CAS 951020-87-4 is the registry number for 1,3-Diethoxyimidazolium hexafluorophosphate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 50g.

Structural formula: {0} (CAS {1})

1,3-diethoxyimidazol-1-ium hexafluorophosphate (CAS 951020-87-4) is a chemical compound with the molecular formula C7H13F6N2O2P and a molecular weight of 302.15 g/mol. IUPAC name: 1,3-diethoxyimidazol-1-ium hexafluorophosphate. InChIKey: OCMLXXOSZWGVIL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13F6N2O2P
Molecular weight302.15 g/mol
IUPAC name1,3-diethoxyimidazol-1-ium hexafluorophosphate
InChIKeyOCMLXXOSZWGVIL-UHFFFAOYSA-N
SMILESCCON1C=C[N+](=C1)OCC.F[P-](F)(F)(F)(F)F

Computed by PubChem (NCBI)