CAS 951021-03-7 is the registry number for 1,3-Dimethoxyimidazolium bis(trifluoromethylsulfonyl)imide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
Bis(trifluoromethylsulfonyl)azanide;1,3-dimethoxyimidazol-1-ium (CAS 951021-03-7) is a chemical compound with the molecular formula C7H9F6N3O6S2 and a molecular weight of 409.3 g/mol. IUPAC name: bis(trifluoromethylsulfonyl)azanide;1,3-dimethoxyimidazol-1-ium. InChIKey: PPGPWZWXCSNVNK-UHFFFAOYSA-N.
| Molecular formula | C7H9F6N3O6S2 |
|---|---|
| Molecular weight | 409.3 g/mol |
| IUPAC name | bis(trifluoromethylsulfonyl)azanide;1,3-dimethoxyimidazol-1-ium |
| InChIKey | PPGPWZWXCSNVNK-UHFFFAOYSA-N |
| SMILES | CON1C=C[N+](=C1)OC.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)