Products 951030-57-2

CAS 951030-57-2 appears in our catalog under these names: 2,5-Dimethylisonicotinic acid, 95%, 2,5-Dimethylisonicotinic acid, 98+%, 2,5-Dimethylisonicotinic acid, 97%, 97%, 2,5-Dimethylpyridine-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2,5-dimethylpyridine-4-carboxylic acid (CAS 951030-57-2) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 2,5-dimethylpyridine-4-carboxylic acid. InChIKey: CADZSRNNJKOKIR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO2
Molecular weight151.16 g/mol
IUPAC name2,5-dimethylpyridine-4-carboxylic acid
InChIKeyCADZSRNNJKOKIR-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=N1)C)C(=O)O

Computed by PubChem (NCBI)