CAS 951322-11-5 appears in our catalog under these names: Desformylflustrabromine hydrochloride, Desformylflustrabromine Hydrochloride, Desformylflustrabromine hydrochloride/ 98.51% (existing batch purity), Desformylflustrabromine HCl 98%, 1H-Indole-3-ethanamine, 6-bromo-2-(1,1-dimethyl-2-propen-1-yl)-N-methyl-, hydrochloride (1:1), 98%, 98%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 5mg, 2,5g, 2mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2-[6-bromo-2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]-N-methylethanamine;hydrochloride (CAS 951322-11-5) is a chemical compound with the molecular formula C16H22BrClN2 and a molecular weight of 357.7 g/mol. IUPAC name: 2-[6-bromo-2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]-N-methylethanamine;hydrochloride. InChIKey: GEZWEAPBLKXKGN-UHFFFAOYSA-N.
| Molecular formula | C16H22BrClN2 |
|---|---|
| Molecular weight | 357.7 g/mol |
| IUPAC name | 2-[6-bromo-2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]-N-methylethanamine;hydrochloride |
| InChIKey | GEZWEAPBLKXKGN-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C1=C(C2=C(N1)C=C(C=C2)Br)CCNC.Cl |
Computed by PubChem (NCBI)