CAS 951380-42-0 is the registry number for Prasugrel Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3,4,6,7-tetrahydrothieno[3,2-c]pyridin-2-one (CAS 951380-42-0) is a chemical compound with the molecular formula C18H18FNO2S and a molecular weight of 331.4 g/mol. IUPAC name: 5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3,4,6,7-tetrahydrothieno[3,2-c]pyridin-2-one. InChIKey: ZIRLXIMCYJFTSB-UHFFFAOYSA-N.
| Molecular formula | C18H18FNO2S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3,4,6,7-tetrahydrothieno[3,2-c]pyridin-2-one |
| InChIKey | ZIRLXIMCYJFTSB-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C(C2=CC=CC=C2F)N3CCC4=C(C3)CC(=O)S4 |
Computed by PubChem (NCBI)